* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-2-(2,6,7,8-tetrahydro-1H-indeno[5,4-b]furan-8-yl)acetic acid |
CAS: | 1092507-02-2 |
English Synonyms: | (R)-2-(2,6,7,8-TETRAHYDRO-1H-INDENO[5,4-B]FURAN-8-YL)ACETIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1C2=C(OC1)C=CC=1CC[C@@H](C12)CC(=O)O |
InChi: | InChI=1S/C13H14O3/c14-12(15)7-9-2-1-8-3-4-11-10(13(8)9)5-6-16-11/h3-4,9H,1-2,5-7H2,(H,14,15)/t9-/m1/s1 |
InChiKey: | InChIKey=STJFPPKIYLSEKU-SECBINFHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.