* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROLO[3',2':4,5]PYRROLO[2,3-C]PYRIDINE |
| CAS: | 1095911-39-9 |
| English Synonyms: | PYRROLO[3',2':4,5]PYRROLO[2,3-C]PYRIDINE |
| MDL Number.: | MFCD12964691 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cncc2c1C3=CC=NC3=N2 |
| InChi: | InChI=1S/C9H5N3/c1-3-10-5-8-6(1)7-2-4-11-9(7)12-8/h1-5H |
| InChiKey: | InChIKey=UQNBBBBSVHVXOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.