* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Bromo-4'-ethynyl-biphenyl |
CAS: | 109797-76-4 |
English Synonyms: | 4-BROMO-4'-ETHYNYL-BIPHENYL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=C(C=C1)C1=CC=C(C=C1)C#C |
InChi: | InChI=1S/C14H9Br/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h1,3-10H |
InChiKey: | InChIKey=MMMFPKZRALWAQL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.