* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISO-ISOVELLERAL |
CAS: | 109956-89-0 |
English Synonyms: | ISO-ISOVELLERAL |
MDL Number.: | MFCD02752161 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1(CC2C=C(C3(CC3(C2C1)C)C=O)C=O)C |
InChi: | InChI=1S/C15H20O2/c1-13(2)5-10-4-11(7-16)15(9-17)8-14(15,3)12(10)6-13/h4,7,9-10,12H,5-6,8H2,1-3H3 |
InChiKey: | InChIKey=PJAAESPGJOSQGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.