* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-NITROBENZYL)MALONATE |
CAS: | 110270-80-9 |
English Synonyms: | RARECHEM DK HD C007 ; 2-(4-NITROBENZYL)MALONATE |
MDL Number.: | MFCD03003358 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cc(ccc1CC(C(=O)O)C(=O)O)[N+](=O)[O-] |
InChi: | InChI=1S/C10H9NO6/c12-9(13)8(10(14)15)5-6-1-3-7(4-2-6)11(16)17/h1-4,8H,5H2,(H,12,13)(H,14,15) |
InChiKey: | InChIKey=LDIKKFOPLVSXKD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.