* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Oxo-4-[[6-[6-(2-pyridinyl)-1,2,4,5-tetrazin-3-yl]-3-pyridinyl]amino]butanoic acid |
CAS: | 1104077-91-9 |
English Synonyms: | 4-OXO-4-[[6-[6-(2-PYRIDINYL)-1,2,4,5-TETRAZIN-3-YL]-3-PYRIDINYL]AMINO]BUTANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O=C(CCC(=O)O)NC=1C=NC(=CC1)C=1N=NC(=NN1)C1=NC=CC=C1 |
InChi: | InChI=1S/C16H13N7O3/c24-13(6-7-14(25)26)19-10-4-5-12(18-9-10)16-22-20-15(21-23-16)11-3-1-2-8-17-11/h1-5,8-9H,6-7H2,(H,19,24)(H,25,26) |
InChiKey: | InChIKey=SSZNHHXXASGOOX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.