* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KALAFUNGIN |
| CAS: | 11048-15-0 |
| English Synonyms: | KALAFUNGIN |
| MDL Number.: | MFCD00865583 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | C[C@H]1C2=C([C@H]3[C@@H](O1)OC(=O)O3)C(=O)c4cccc(c4C2=O)O |
| InChi: | InChI=1S/C15H10O7/c1-5-8-10(13-14(20-5)22-15(19)21-13)11(17)6-3-2-4-7(16)9(6)12(8)18/h2-5,13-14,16H,1H3/t5-,13-,14-/m0/s1 |
| InChiKey: | InChIKey=MCSWCIQAECMQGP-XRDMCUQDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.