* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LINETASTINE |
CAS: | 110501-66-1 ;159776-68-8 |
English Synonyms: | LINETASTINE |
MDL Number.: | MFCD00872251 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CCOC(=O)Oc1ccc(cc1OC)/C=C/C=C/C(=O)NCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4 |
InChi: | InChI=1S/C35H40N2O6/c1-3-41-35(39)43-31-19-18-27(26-32(31)40-2)12-10-11-17-33(38)36-22-25-37-23-20-30(21-24-37)42-34(28-13-6-4-7-14-28)29-15-8-5-9-16-29/h4-19,26,30,34H,3,20-25H2,1-2H3,(H,36,38)/b12-10+,17-11+ |
InChiKey: | InChIKey=LUOUCHOLMUUZBO-SVSXJNCISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.