* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | POROTHRAMYCIN B |
CAS: | 110652-72-7 |
English Synonyms: | POROTHRAMYCIN B |
MDL Number.: | MFCD01696401 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CN(C)C(=O)/C=C/C1=CN2[C@@H](C1)[C@H](Nc3c(cccc3OC)C2=O)OC |
InChi: | InChI=1S/C19H23N3O4/c1-21(2)16(23)9-8-12-10-14-18(26-4)20-17-13(19(24)22(14)11-12)6-5-7-15(17)25-3/h5-9,11,14,18,20H,10H2,1-4H3/b9-8+/t14-,18+/m0/s1 |
InChiKey: | InChIKey=XCFSBOSFMAOQAL-MFUPGOHSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.