* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Oxazolidinone, 3-(1-oxobutyl)-4-(phenylmethyl)- |
CAS: | 111292-87-6 |
English Synonyms: | 2-OXAZOLIDINONE, 3-(1-OXOBUTYL)-4-(PHENYLMETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O=C(CCC)N1C(OCC1CC1=CC=CC=C1)=O |
InChi: | InChI=1S/C14H17NO3/c1-2-6-13(16)15-12(10-18-14(15)17)9-11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3 |
InChiKey: | InChIKey=HEJIYTVOUUVHRY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.