* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-OXABICYCLO[4.1.0]HEPTANE, 4-[(1Z)-1,5-DIMETHYL-1,4-HEXADIENYL]-1-METHYL-, (1S,4R,6R)- |
| CAS: | 111536-37-9 |
| English Synonyms: | 7-OXABICYCLO[4.1.0]HEPTANE, 4-[(1Z)-1,5-DIMETHYL-1,4-HEXADIENYL]-1-METHYL-, (1S,4R,6R)- |
| MDL Number.: | MFCD18782006 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(=CC/C=C(/C)\[C@@H]1CC[C@]2([C@@H](C1)O2)C)C |
| InChi: | InChI=1S/C15H24O/c1-11(2)6-5-7-12(3)13-8-9-15(4)14(10-13)16-15/h6-7,13-14H,5,8-10H2,1-4H3/b12-7-/t13-,14-,15+/m1/s1 |
| InChiKey: | InChIKey=BOWJPMUUGHPAAF-BMGVKBPPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.