* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[3-(2-Aminoethyl)phenoxy]acetic acid HCl |
CAS: | 111758-57-7 |
English Synonyms: | 2-[3-(2-AMINOETHYL)PHENOXY]ACETIC ACID HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.NCCC=1C=C(OCC(=O)O)C=CC1 |
InChi: | InChI=1S/C10H13NO3.ClH/c11-5-4-8-2-1-3-9(6-8)14-7-10(12)13;/h1-3,6H,4-5,7,11H2,(H,12,13);1H |
InChiKey: | InChIKey=ITKOXSNBLTXVLL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.