* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Acetic acid, 2-[3-(2-aminoethyl)phenoxy]- |
CAS: | 111762-11-9 |
English Synonyms: | ACETIC ACID, 2-[3-(2-AMINOETHYL)PHENOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCC=1C=C(OCC(=O)O)C=CC1 |
InChi: | InChI=1S/C10H13NO3/c11-5-4-8-2-1-3-9(6-8)14-7-10(12)13/h1-3,6H,4-5,7,11H2,(H,12,13) |
InChiKey: | InChIKey=AWBCIZDYUXMRKU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.