* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1576 |
CAS: | 1123546-30-4 |
English Synonyms: | ABBYPHARMA AP-10-1576 |
MDL Number.: | MFCD16988144 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COC1=NC(=CC(=O)N1)C(O)=O |
InChi: | InChI=1S/C6H6N2O4/c1-12-6-7-3(5(10)11)2-4(9)8-6/h2H,1H3,(H,10,11)(H,7,8,9) |
InChiKey: | InChIKey=ZXIMJWDECSGSPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.