* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(2,5-DIETHOXYPHENYL)-1,3-THIAZOL-2-AMINE |
CAS: | 112434-78-3 |
English Synonyms: | 4-(2,5-DIETHOXYPHENYL)-1,3-THIAZOL-2-AMINE |
MDL Number.: | MFCD02663892 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOc1ccc(c(c1)c2csc(n2)N)OCC |
InChi: | InChI=1S/C13H16N2O2S/c1-3-16-9-5-6-12(17-4-2)10(7-9)11-8-18-13(14)15-11/h5-8H,3-4H2,1-2H3,(H2,14,15) |
InChiKey: | InChIKey=DWJYGVYYJHAFFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.