* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Oxazolidinone, 3-(1-oxobutyl)-4-phenyl-, (4S)- |
CAS: | 112459-76-4 |
English Synonyms: | 2-OXAZOLIDINONE, 3-(1-OXOBUTYL)-4-PHENYL-, (4S)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O=C(CCC)N1C(OC[C@@H]1C1=CC=CC=C1)=O |
InChi: | InChI=1S/C13H15NO3/c1-2-6-12(15)14-11(9-17-13(14)16)10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9H2,1H3/t11-/m1/s1 |
InChiKey: | InChIKey=WYQUQXYTFMHCOL-LLVKDONJSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.