* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-1H-INDAZOL-6-AMINE |
CAS: | 112635-08-2 |
English Synonyms: | INDAZOL-6-AMINE, 7-CHLORO- ; 7-CHLORO-1H-INDAZOL-6-AMINE |
MDL Number.: | MFCD17010081 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(c(c2c1cn[nH]2)Cl)N |
InChi: | InChI=1S/C7H6ClN3/c8-6-5(9)2-1-4-3-10-11-7(4)6/h1-3H,9H2,(H,10,11) |
InChiKey: | InChIKey=VMGQDKDTKMNMEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.