* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OBELMYCIN H |
| CAS: | 112720-41-9 |
| English Synonyms: | OBELMYCIN H |
| MDL Number.: | MFCD00952008 |
| H bond acceptor: | 12 |
| H bond donor: | 7 |
| Smile: | CC[C@]1(C[C@@H](c2c(c(c3c(c2O)C(=O)c4c(ccc(c4C3=O)O)O)O)[C@H]1O[C@@H]5C[C@H]([C@H]([C@H](O5)C)O)N(C)C)O)O |
| InChi: | InChI=1S/C28H33NO11/c1-5-28(38)9-14(32)18-21(27(28)40-15-8-11(29(3)4)22(33)10(2)39-15)26(37)20-19(25(18)36)23(34)16-12(30)6-7-13(31)17(16)24(20)35/h6-7,10-11,14-15,22,27,30-33,36-38H,5,8-9H2,1-4H3/t10-,11-,14+,15-,22+,27-,28-/m1/s1 |
| InChiKey: | InChIKey=CXCRIUPPLCQPTC-WSXCSCIMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.