* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RENZAPRIDE |
CAS: | 112727-80-7 |
English Synonyms: | RENZAPRIDE |
MDL Number.: | MFCD00869601 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1cc(c(cc1C(=O)N[C@@H]2CCN3CCC[C@H]2C3)Cl)N |
InChi: | InChI=1S/C16H22ClN3O2/c1-22-15-8-13(18)12(17)7-11(15)16(21)19-14-4-6-20-5-2-3-10(14)9-20/h7-8,10,14H,2-6,9,18H2,1H3,(H,19,21)/t10-,14+/m0/s1 |
InChiKey: | InChIKey=GZSKEXSLDPEFPT-IINYFYTJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.