* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-SAR-PRO-ARG-OH |
CAS: | 112898-31-4 |
English Synonyms: | Z-SAR-PRO-ARG-OH |
MDL Number.: | MFCD00058567 |
H bond acceptor: | 12 |
H bond donor: | 5 |
Smile: | CN(CC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C(=O)OCc2ccccc2 |
InChi: | InChI=1S/C22H32N6O6/c1-27(22(33)34-14-15-7-3-2-4-8-15)13-18(29)28-12-6-10-17(28)19(30)26-16(20(31)32)9-5-11-25-21(23)24/h2-4,7-8,16-17H,5-6,9-14H2,1H3,(H,26,30)(H,31,32)(H4,23,24,25)/t16-,17-/m0/s1 |
InChiKey: | InChIKey=PSXDICJGJXJQAQ-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.