* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-PHENYL-3H,6H,7H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-7-ONE |
CAS: | 114306-16-0 |
English Synonyms: | 3-PHENYL-3H,6H,7H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-7-ONE ; 3-PHENYL-6H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-7-ONE ; 3-PHENYL-3,6-DIHYDRO-7H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-7-ONE |
MDL Number.: | MFCD03011619 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)n2c3c(c(=O)[nH]cn3)nn2 |
InChi: | InChI=1S/C10H7N5O/c16-10-8-9(11-6-12-10)15(14-13-8)7-4-2-1-3-5-7/h1-6H,(H,11,12,16) |
InChiKey: | InChIKey=OVYUDMXZLUQNFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.