* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-2-chloro-1-(2,4-dichlorophenyl)ethan-1-ol |
CAS: | 114446-57-0 |
English Synonyms: | (R)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHAN-1-OL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC[C@H](O)C1=C(C=C(C=C1)Cl)Cl |
InChi: | InChI=1S/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/m0/s1 |
InChiKey: | InChIKey=XHEPANNURIQWRM-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.