* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GANODERIOL F |
CAS: | 114567-47-4 |
English Synonyms: | GANODERIOL F |
MDL Number.: | MFCD17214920 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C[C@H](CCC=C(CO)CO)[C@H]1CC[C@@]2([C@@]1(CC=C3C2=CC[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
InChi: | InChI=1S/C30H46O3/c1-20(8-7-9-21(18-31)19-32)22-12-16-30(6)24-10-11-25-27(2,3)26(33)14-15-28(25,4)23(24)13-17-29(22,30)5/h9-10,13,20,22,25,31-32H,7-8,11-12,14-19H2,1-6H3/t20-,22-,25+,28-,29-,30+/m1/s1 |
InChiKey: | InChIKey=JVGJXXNUVVQEIG-MCKXIFHVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.