Molecular Structure:
CAS No.:
114875-57-9
Product Name.:
CCD No.:CCD00178630
Formula:C21 H18 N8 O8 S4
MolWeight:638.685
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | KP 736 |
| CAS： | 114875-57-9 |
| English Synonyms： | KP 736 |
| MDL Number.： | MFCD00875766 |
| H bond acceptor： | 16 |
| H bond donor： | 5 |
| Smile： | c1c(n(cc(c1=O)O)O)CO/N=C(/c2csc(n2)N)\C(=O)N[C@H]3[C@@H]4N(C3=O)C(=C(CS4)CSc5cnns5)C(=O)O |
| InChi： | InChI=1S/C21H18N8O8S4/c22-21-24-10(7-40-21)14(26-37-4-9-1-11(30)12(31)3-28(9)36)17(32)25-15-18(33)29-16(20(34)35)8(6-39-19(15)29)5-38-13-2-23-27-41-13/h1-3,7,15,19,31,36H,4-6H2,(H2,22,24)(H,25,32)(H,34,35)/b26-14-/t15-,19-/m1/s1 |
| InChiKey： | InChIKey=PKNTVKPWSREWQQ-ARLAXHMGSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
