* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-[(ACETYLOXY)METHYL]-2(3H)-PYRIDINONE |
CAS: | 114951-42-7 |
English Synonyms: | 5-[(ACETYLOXY)METHYL]-2(3H)-PYRIDINONE |
MDL Number.: | MFCD18836936 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)OCC1=CCC(=O)N=C1 |
InChi: | InChI=1S/C8H9NO3/c1-6(10)12-5-7-2-3-8(11)9-4-7/h2,4H,3,5H2,1H3 |
InChiKey: | InChIKey=OTLQNWCGEDVLTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.