* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-HYDROXYBENFLURON |
CAS: | 115029-30-6 |
English Synonyms: | 9-HYDROXYBENFLURON |
MDL Number.: | MFCD00871479 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN(C)CCOc1cc2c(c3c1cccc3)-c4ccc(cc4C2=O)O |
InChi: | InChI=1S/C21H19NO3/c1-22(2)9-10-25-19-12-18-20(15-6-4-3-5-14(15)19)16-8-7-13(23)11-17(16)21(18)24/h3-8,11-12,23H,9-10H2,1-2H3 |
InChiKey: | InChIKey=SAMGZMAPTSFCLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.