* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-Decenoic acid, 2-amino-, (S)- |
CAS: | 115042-85-8 |
English Synonyms: | 9-DECENOIC ACID, 2-AMINO-, (S)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N[C@H](C(=O)O)CCCCCCC=C |
InChi: | InChI=1S/C10H19NO2/c1-2-3-4-5-6-7-8-9(11)10(12)13/h2,9H,1,3-8,11H2,(H,12,13)/t9-/m0/s1 |
InChiKey: | InChIKey=XDHWDJVNBSJHRY-VIFPVBQESA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.