* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Pentanoic acid, 5-(2-propyn-1-yloxy)- |
CAS: | 1152591-99-5 |
English Synonyms: | PENTANOIC ACID, 5-(2-PROPYN-1-YLOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C#C)OCCCCC(=O)O |
InChi: | InChI=1S/C8H12O3/c1-2-6-11-7-4-3-5-8(9)10/h1H,3-7H2,(H,9,10) |
InChiKey: | InChIKey=OMKWUAOOEITKQA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.