* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ETHYL-1,5-DIHYDRO-2H-PYRROL-2-ONE |
CAS: | 115600-67-4 |
English Synonyms: | 4-ETHYL-1,5-DIHYDRO-2H-PYRROL-2-ONE ; 4-ETHYL-2,5-DIHYDRO-1H-PYRROL-2-ONE |
MDL Number.: | MFCD12923614 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC1=CC(=O)NC1 |
InChi: | InChI=1S/C6H9NO/c1-2-5-3-6(8)7-4-5/h3H,2,4H2,1H3,(H,7,8) |
InChiKey: | InChIKey=FGKDKXXYUIGVHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.