* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IDE 1 |
CAS: | 1160927-48-9 |
English Synonyms: | IDE 1 |
MDL Number.: | MFCD17480459 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)/C=N/NC(=O)CCCCCC(=O)O)C(=O)O |
InChi: | InChI=1S/C15H18N2O5/c18-13(8-2-1-3-9-14(19)20)17-16-10-11-6-4-5-7-12(11)15(21)22/h4-7,10H,1-3,8-9H2,(H,17,18)(H,19,20)(H,21,22)/b16-10+ |
InChiKey: | InChIKey=ABKJCDILEUEJSH-MHWRWJLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.