* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 11-METHOXY-7-METHYL-1,2,3,10,11,11A-HEXAHYDRO-5H-PYRROLO(2,1-C)(1,4)BE NZODIAZEPIN-5-ONE |
CAS: | 116564-73-9 |
English Synonyms: | 11-METHOXY-7-METHYL-1,2,3,10,11,11A-HEXAHYDRO-5H-PYRROLO(2,1-C)(1,4)BE NZODIAZEPIN-5-ONE |
MDL Number.: | MFCD01687025 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc2c(c1)C(=O)N3CCCC3C(N2)OC |
InChi: | InChI=1S/C14H18N2O2/c1-9-5-6-11-10(8-9)14(17)16-7-3-4-12(16)13(15-11)18-2/h5-6,8,12-13,15H,3-4,7H2,1-2H3 |
InChiKey: | InChIKey=JDVBSBADDFBZHE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.