* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIAZOLO[5,4-C]PYRIDINE-2-THIOL |
CAS: | 116990-44-4 |
English Synonyms: | THIAZOLO[5,4-C]PYRIDINE-2-THIOL ; [1,3]THIAZOLO[5,4-C]PYRIDINE-2-THIOL ; ABBYPHARMA AP-11-10136 |
MDL Number.: | MFCD12755950 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cncc2c1nc(s2)S |
InChi: | InChI=1S/C6H4N2S2/c9-6-8-4-1-2-7-3-5(4)10-6/h1-3H,(H,8,9) |
InChiKey: | InChIKey=VHVPVAPCPMORFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.