* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LEU-PNA |
| CAS: | 1174-27-2 |
| English Synonyms: | Z-LEU-PNA ; Z-L-LEUCINE-P-NITROANILIDE |
| MDL Number.: | MFCD00191114 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C)C[C@@H](C(=O)Nc1ccc(cc1)[N+](=O)[O-])NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C20H23N3O5/c1-14(2)12-18(22-20(25)28-13-15-6-4-3-5-7-15)19(24)21-16-8-10-17(11-9-16)23(26)27/h3-11,14,18H,12-13H2,1-2H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChiKey: | InChIKey=WFFYUGQKEFKRAI-SFHVURJKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.