* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzonitrile, 3-(2-hydroxypropoxy)- |
CAS: | 1178176-69-6 |
English Synonyms: | BENZONITRILE, 3-(2-HYDROXYPROPOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OC(COC=1C=C(C#N)C=CC1)C |
InChi: | InChI=1S/C10H11NO2/c1-8(12)7-13-10-4-2-3-9(5-10)6-11/h2-5,8,12H,7H2,1H3 |
InChiKey: | InChIKey=LNSDAKDPLKABPL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.