* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzonitrile, 4-(2-hydroxypropoxy)- |
CAS: | 1179108-50-9 |
English Synonyms: | BENZONITRILE, 4-(2-HYDROXYPROPOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OC(COC1=CC=C(C#N)C=C1)C |
InChi: | InChI=1S/C10H11NO2/c1-8(12)7-13-10-4-2-9(6-11)3-5-10/h2-5,8,12H,7H2,1H3 |
InChiKey: | InChIKey=IRRTYDOFRMTWQB-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.