* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-NITRO-4,5-DIHYDROPYRENE |
CAS: | 117929-14-3 |
English Synonyms: | 2-NITRO-4,5-DIHYDROPYRENE |
MDL Number.: | MFCD01692957 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc2ccc3cc(cc4c3c2c(c1)CC4)[N+](=O)[O-] |
InChi: | InChI=1S/C16H11NO2/c18-17(19)14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-4,6,8-9H,5,7H2 |
InChiKey: | InChIKey=PFJHRZVXVLINNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.