* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-N-Cbz-butane-1,2-diamine |
CAS: | 1179533-47-1 |
English Synonyms: | 2-N-CBZ-BUTANE-1,2-DIAMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1=CC=CC=C1)NC(CN)CC |
InChi: | InChI=1S/C12H18N2O2/c1-2-11(8-13)14-12(15)16-9-10-6-4-3-5-7-10/h3-7,11H,2,8-9,13H2,1H3,(H,14,15) |
InChiKey: | InChIKey=CWOTXZZMEPSBPP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.