* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 11-Azido-undecanoic acid |
CAS: | 118162-45-1 |
English Synonyms: | 11-AZIDO-UNDECANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCCCCCCCCC(=O)O |
InChi: | InChI=1S/C11H21N3O2/c12-14-13-10-8-6-4-2-1-3-5-7-9-11(15)16/h1-10H2,(H,15,16) |
InChiKey: | InChIKey=LXAVFOAOGZWQKT-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.