* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-PIMOBENDAN |
CAS: | 118428-37-8 |
English Synonyms: | L-PIMOBENDAN |
MDL Number.: | MFCD01692680 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C[C@H]1CC(=O)NN=C1c2ccc3c(c2)nc([nH]3)c4ccc(cc4)OC |
InChi: | InChI=1S/C19H18N4O2/c1-11-9-17(24)22-23-18(11)13-5-8-15-16(10-13)21-19(20-15)12-3-6-14(25-2)7-4-12/h3-8,10-11H,9H2,1-2H3,(H,20,21)(H,22,24)/t11-/m0/s1 |
InChiKey: | InChIKey=GLBJJMFZWDBELO-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.