Molecular Structure:
CAS No.:
118974-02-0
Product Name.:
CCD No.:CCD00690252
Formula:C22 H25 N3 O3
MolWeight:379.457
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | FUMITREMORGIN C |
| CAS： | 118974-02-0 |
| English Synonyms： | SM-Q ; FTC ; FUMITREMORGIN C |
| MDL Number.： | MFCD08702652 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CC(=C[C@H]1c2c(c3ccc(cc3[nH]2)OC)C[C@@H]4N1C(=O)[C@@H]5CCCN5C4=O)C |
| InChi： | InChI=1S/C22H25N3O3/c1-12(2)9-18-20-15(14-7-6-13(28-3)10-16(14)23-20)11-19-21(26)24-8-4-5-17(24)22(27)25(18)19/h6-7,9-10,17-19,23H,4-5,8,11H2,1-3H3/t17-,18-,19-/m0/s1 |
| InChiKey： | InChIKey=DBEYVIGIPJSTOR-FHWLQOOXSA-N |
|
|
|
|
| Safe Code： | S:22,24/25 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
