* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | tert-butyl hept-6-yn-1-ylcarbamate |
CAS: | 1192373-48-0 |
English Synonyms: | TERT-BUTYL HEPT-6-YN-1-YLCARBAMATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CCCCC#C)NC(OC(C)(C)C)=O |
InChi: | InChI=1S/C12H21NO2/c1-5-6-7-8-9-10-13-11(14)15-12(2,3)4/h1H,6-10H2,2-4H3,(H,13,14) |
InChiKey: | InChIKey=DDSWEPQENPIPFI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.