* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BENZO(F)QUINOLINE-9,10-DIOL-7,8-EPOXIDE |
CAS: | 119239-65-5 |
English Synonyms: | BENZO(F)QUINOLINE-9,10-DIOL-7,8-EPOXIDE |
MDL Number.: | MFCD02751809 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(ccc3c2C4C(O4)C(=C3O)O)nc1 |
InChi: | InChI=1S/C13H9NO3/c15-10-7-3-4-8-6(2-1-5-14-8)9(7)12-13(17-12)11(10)16/h1-5,12-13,15-16H |
InChiKey: | InChIKey=YACSELLFTIPGLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.