* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDAZOLE, 4-CHLORO-1-HYDROXY- |
CAS: | 1193266-47-5 |
English Synonyms: | INDAZOLE, 4-CHLORO-1-HYDROXY- |
MDL Number.: | MFCD17010093 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(cnn2O)c(c1)Cl |
InChi: | InChI=1S/C7H5ClN2O/c8-6-2-1-3-7-5(6)4-9-10(7)11/h1-4,11H |
InChiKey: | InChIKey=RONMPTHACQLSGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.