* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | R-5,5',6,6',7,7',8,8'-OCTAHYDRO-1,1'-BI-2-NAPHTHYL PHOSPHATE |
CAS: | 297752-25-1 ;1193697-61-8 |
English Synonyms: | S-5,5',6,6',7,7',8,8'-OCTAHYDRO-1,1'-BI-2-NAPHTHYL PHOSPHATE ; R-5,5',6,6',7,7',8,8'-OCTAHYDRO-1,1'-BI-2-NAPHTHYL PHOSPHATE ; 4-OXO-8,9,10,11,12,13,14,15-OCTAHYDRO-3,5-DIOXA-4-PHOSPHA-CYCLOHEPTA[2,1-A:3,4-A']DINAPHTHALEN-4-OL |
MDL Number.: | MFCD22200734 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(c3c1CCCC3)-c4c(ccc5c4CCCC5)OP(=O)(O2)O |
InChi: | InChI=1S/C20H21O4P/c21-25(22)23-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)24-25/h9-12H,1-8H2,(H,21,22) |
InChiKey: | InChIKey=HCTOYKLUBVCMFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.