* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PENDOLMYCIN |
CAS: | 119375-01-8 |
English Synonyms: | PENDOLMYCIN |
MDL Number.: | MFCD02751969 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(C)C1C(=O)NC(Cc2c[nH]c3c2c(ccc3C(C)(C)C=C)N1C)CO |
InChi: | InChI=1S/C22H31N3O2/c1-7-22(4,5)16-8-9-17-18-14(11-23-19(16)18)10-15(12-26)24-21(27)20(13(2)3)25(17)6/h7-9,11,13,15,20,23,26H,1,10,12H2,2-6H3,(H,24,27) |
InChiKey: | InChIKey=JPJWIAYMFHOJRY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.