* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4-TETRAHYDRO-2-(1-OXO-3-(1-PIPERIDINYL)PROPYL)-1-(3-PYRIDINYL)-9 H-PYRIDO(3,4-B)INDOLE |
CAS: | 119464-27-6 |
English Synonyms: | 1,2,3,4-TETRAHYDRO-2-(1-OXO-3-(1-PIPERIDINYL)PROPYL)-1-(3-PYRIDINYL)-9 H-PYRIDO(3,4-B)INDOLE |
MDL Number.: | MFCD01690342 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c3c([nH]2)C(N(CC3)C(=O)CCN4CCCCC4)c5cccnc5 |
InChi: | InChI=1S/C24H28N4O/c29-22(11-15-27-13-4-1-5-14-27)28-16-10-20-19-8-2-3-9-21(19)26-23(20)24(28)18-7-6-12-25-17-18/h2-3,6-9,12,17,24,26H,1,4-5,10-11,13-16H2 |
InChiKey: | InChIKey=QSBRTZBQSHLYRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.