* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,5-diethyl-1,3-dioxane-2-thione |
CAS: | 119543-65-6 |
English Synonyms: | 5,5-DIETHYL-1,3-DIOXANE-2-THIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)C1(COC(OC1)=S)CC |
InChi: | InChI=1S/C8H14O2S/c1-3-8(4-2)5-9-7(11)10-6-8/h3-6H2,1-2H3 |
InChiKey: | InChIKey=ZTBZWXPGUKSAHX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.