* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-TRP-OH |
| CAS: | 119645-65-7 |
| English Synonyms: | Z-L-ALANYL-L-TRYPTOPHAN ; Z-ALA-TRP-OH |
| MDL Number.: | MFCD00022761 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | C[C@@H](C(=O)N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)O)NC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C22H23N3O5/c1-14(24-22(29)30-13-15-7-3-2-4-8-15)20(26)25-19(21(27)28)11-16-12-23-18-10-6-5-9-17(16)18/h2-10,12,14,19,23H,11,13H2,1H3,(H,24,29)(H,25,26)(H,27,28)/t14-,19-/m0/s1 |
| InChiKey: | InChIKey=OEANOUHCLXZBNG-LIRRHRJNSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.