* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ERYLOSIDE A |
| CAS: | 119760-82-6 |
| English Synonyms: | ERYLOSIDE A |
| MDL Number.: | MFCD00886573 |
| H bond acceptor: | 12 |
| H bond donor: | 8 |
| Smile: | C[C@H]1[C@@H]2CCC3=C([C@]2(CC[C@@H]1O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O[C@H]5[C@H]([C@H]([C@H]([C@H](O5)CO)O)O)O)C)CC[C@]6(C3=CC[C@@H]6[C@H](C)CC(CC(C)C)O)C |
| InChi: | InChI=1S/C40H66O12/c1-19(2)15-22(43)16-20(3)24-9-10-26-23-7-8-25-21(4)28(12-14-40(25,6)27(23)11-13-39(24,26)5)49-38-36(34(47)32(45)30(18-42)51-38)52-37-35(48)33(46)31(44)29(17-41)50-37/h10,19-22,24-25,28-38,41-48H,7-9,11-18H2,1-6H3/t20-,21+,22?,24-,25+,28+,29-,30-,31+,32+,33+,34+,35+,36-,37+,38-,39-,40+/m1/s1 |
| InChiKey: | InChIKey=IVYRDMWWABSYSI-YKGMBDDRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.