* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-4-ethanol, 4'-(pentyloxy)- |
CAS: | 1201511-19-4 |
English Synonyms: | [1,1'-BIPHENYL]-4-ETHANOL, 4'-(PENTYLOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CCCC)OC1=CC=C(C=C1)C1=CC=C(C=C1)CCO |
InChi: | InChI=1S/C19H24O2/c1-2-3-4-15-21-19-11-9-18(10-12-19)17-7-5-16(6-8-17)13-14-20/h5-12,20H,2-4,13-15H2,1H3 |
InChiKey: | InChIKey=NOSVDTMNWPHCDU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.